What is the 3,4-Dimethylbenzylamine?

3,4-Dimethylbenzylamine is white powder, while it's Molecular Formula is C9H13N. white powder Used in Organic Synthesis: 3,4-Dimethylbenzylamine is used as a synthetic intermediate for the production of various organic compounds. Its unique structure allows it to be a key component in the synthesis of a range of molecules, contributing to the diversity of organic chemistry. Used in Pharmaceutical Research: In the pharmaceutical industry, 3,4-Dimethylbenzylamine is utilized as a building block for the development of new drugs. Its ability to participate in multiple chemical reactions makes it instrumental in the creation of novel pharmaceutical agents, potentially leading to advancements in medicinal chemistry and drug discovery. Used in Chemical Reactions: 3,4-Dimethylbenzylamine is used as a reactant in various chemical reactions, such as amination, acylation, and other functional group transformations. Its reactivity and structural features make it a valuable asset in the synthesis of complex organic molecules and the modification of existing compounds to enhance their properties or create new functionalities.

What is the CAS number for 3,4-Dimethylbenzylamine?

The CAS number of 3,4-Dimethylbenzylamine is 102-48-7.

What is 3,4-Dimethylbenzylamine (102-48-7) used for?

3,4-Dimethylbenzylamine, also known as (3,4-Dimethylphenyl)methanamine, is an organic compound that functions as a crucial intermediate in the fields of organic synthesis and pharmaceutical research. Characterized by its versatile chemical structure, it is capable of engaging in a wide array of chemical reactions, which positions it as a pivotal building block for the development of more complex molecules.InChI:InChI=1/C9H13N/c1-7-3-4-9(6-10)5-8(7)2/h3-5H,6,10H2,1-2H3

What is the 3,4-Dimethylbenzylamine?

3,4-Dimethylbenzylamine is white powder, while it's Molecular Formula is C9H13N. white powder Used in Organic Synthesis: 3,4-Dimethylbenzylamine is used as a synthetic intermediate for the production of various organic compounds. Its unique structure allows it to be a key component in the synthesis of a range of molecules, contributing to the diversity of organic chemistry. Used in Pharmaceutical Research: In the pharmaceutical industry, 3,4-Dimethylbenzylamine is utilized as a building block for the development of new drugs. Its ability to participate in multiple chemical reactions makes it instrumental in the creation of novel pharmaceutical agents, potentially leading to advancements in medicinal chemistry and drug discovery. Used in Chemical Reactions: 3,4-Dimethylbenzylamine is used as a reactant in various chemical reactions, such as amination, acylation, and other functional group transformations. Its reactivity and structural features make it a valuable asset in the synthesis of complex organic molecules and the modification of existing compounds to enhance their properties or create new functionalities.

What is the CAS number for 3,4-Dimethylbenzylamine?

The CAS number of 3,4-Dimethylbenzylamine is 102-48-7.

What is 3,4-Dimethylbenzylamine (102-48-7) used for?

3,4-Dimethylbenzylamine, also known as (3,4-Dimethylphenyl)methanamine, is an organic compound that functions as a crucial intermediate in the fields of organic synthesis and pharmaceutical research. Characterized by its versatile chemical structure, it is capable of engaging in a wide array of chemical reactions, which positions it as a pivotal building block for the development of more complex molecules.InChI:InChI=1/C9H13N/c1-7-3-4-9(6-10)5-8(7)2/h3-5H,6,10H2,1-2H3

3,4-Dimethylbenzylamine

Base Information

Chemical Name:3,4-Dimethylbenzylamine
CAS No.:102-48-7

Excellent chemical plant bulk supply 3,4-Dimethylbenzylamine 102-48-7

Molecular Formula:C9H13N
Molecular Weight:135.209
Appearance/Colour:white powder
Vapor Pressure:0.0811mmHg at 25°C
Refractive Index:1.537
Boiling Point:226.6 °C at 760 mmHg
PKA:9.28±0.10(Predicted)
Flash Point:93.9 °C
PSA：26.02000
Density:0.9524 g/cm³
LogP:2.46240

3,4-Dimethylbenzylamine(Cas 102-48-7) Usage

General Description

(3,4-Dimethylphenyl)methanamine, also known as 3,4-Dimethylbenzylamine, serves as a valuable intermediate in organic synthesis and pharmaceutical research. Its versatile chemical structure allows it to participate in various chemical reactions, making it a key building block for the creation of more complex molecules.

InChI:InChI=1/C9H13N/c1-7-3-4-9(6-10)5-8(7)2/h3-5H,6,10H2,1-2H3